C18H24N4O2 — CID 56718530
(2S,4R)-4-amino-N-methyl-1-(1,3,7-trimethylindole-2-carbonyl)pyrrolidine-2-carboxamide (PubChem CID 56718530) has the molecular formula C18H24N4O2 and a molecular weight of 328.42 g/mol. Its IUPAC name is (2S,4R)-4-amino-N-methyl-1-(1,3,7-trimethylindole-2-carbonyl)pyrrolidine-2-carboxamide.
| Compound Name | (2S,4R)-4-amino-N-methyl-1-(1,3,7-trimethylindole-2-carbonyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 56718530 |
| Molecular Formula | C18H24N4O2 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | (2S,4R)-4-amino-N-methyl-1-(1,3,7-trimethylindole-2-carbonyl)pyrrolidine-2-carboxamide |
| SMILES | CNC(=O)[C@@H]1C[C@@H](N)CN1C(=O)c1c(C)c2cccc(C)c2n1C |
| InChI | InChI=1S/C18H24N4O2/c1-10-6-5-7-13-11(2)16(21(4)15(10)13)18(24)22-9-12(19)8-14(22)17(23)20-3/h5-7,12,14H,8-9,19H2,1-4H3,(H,20,23)/t12-,14+/m1/s1 |
| InChIKey | OKAOWWLZCUSCDP-OCCSQVGLSA-N |
| XLogP | 1.08 |
| TPSA | 80.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|