About ethyl 2-[1-[[(2S,4R)-4-aminopyrrolidine-2-carbonyl]amino]cyclohexyl]acetate
ethyl 2-[1-[[(2S,4R)-4-aminopyrrolidine-2-carbonyl]amino]cyclohexyl]acetate (PubChem CID 56718696) has the molecular formula C15H27N3O3
and a molecular weight of 297.40 g/mol. Its IUPAC name is ethyl 2-[1-[[(2S,4R)-4-aminopyrrolidine-2-carbonyl]amino]cyclohexyl]acetate.
Molecular Properties
| Compound Name | ethyl 2-[1-[[(2S,4R)-4-aminopyrrolidine-2-carbonyl]amino]cyclohexyl]acetate |
| PubChem CID | 56718696 |
| Molecular Formula | C15H27N3O3 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.21 |
| IUPAC Name | ethyl 2-[1-[[(2S,4R)-4-aminopyrrolidine-2-carbonyl]amino]cyclohexyl]acetate |
| SMILES | CCOC(=O)CC1(NC(=O)[C@@H]2C[C@@H](N)CN2)CCCCC1 |
| InChI | InChI=1S/C15H27N3O3/c1-2-21-13(19)9-15(6-4-3-5-7-15)18-14(20)12-8-11(16)10-17-12/h11-12,17H,2-10,16H2,1H3,(H,18,20)/t11-,12+/m1/s1 |
| InChIKey | SFAUMSLRLFMJLD-NEPJUHHUSA-N |
| XLogP | 0.45 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 2-[1-[[(2S,4R)-4-aminopyrrolidine-2-carbonyl]amino]cyclohexyl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[1-[[(2S,4R)-4-aminopyrrolidine-2-carbonyl]amino]cyclohexyl]acetate?
The IUPAC name of ethyl 2-[1-[[(2S,4R)-4-aminopyrrolidine-2-carbonyl]amino]cyclohexyl]acetate (CID 56718696) is ethyl 2-[1-[[(2S,4R)-4-aminopyrrolidine-2-carbonyl]amino]cyclohexyl]acetate.
What is the SMILES notation for ethyl 2-[1-[[(2S,4R)-4-aminopyrrolidine-2-carbonyl]amino]cyclohexyl]acetate?
The canonical SMILES for ethyl 2-[1-[[(2S,4R)-4-aminopyrrolidine-2-carbonyl]amino]cyclohexyl]acetate is CCOC(=O)CC1(NC(=O)[C@@H]2C[C@@H](N)CN2)CCCCC1.
What is the InChIKey of ethyl 2-[1-[[(2S,4R)-4-aminopyrrolidine-2-carbonyl]amino]cyclohexyl]acetate?
The InChIKey is SFAUMSLRLFMJLD-NEPJUHHUSA-N. The full InChI is InChI=1S/C15H27N3O3/c1-2-21-13(19)9-15(6-4-3-5-7-15)18-14(20)12-8-11(16)10-17-12/h11-12,17H,2-10,16H2,1H3,(H,18,20)/t11-,12+/m1/s1.
What are the key properties of ethyl 2-[1-[[(2S,4R)-4-aminopyrrolidine-2-carbonyl]amino]cyclohexyl]acetate?
ethyl 2-[1-[[(2S,4R)-4-aminopyrrolidine-2-carbonyl]amino]cyclohexyl]acetate has a molecular weight of 297.40 g/mol, XLogP of 0.45, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[1-[[(2S,4R)-4-aminopyrrolidine-2-carbonyl]amino]cyclohexyl]acetate is sourced from PubChem (CID 56718696), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).