C14H19N5O2 — CID 56718919
N-[3-(3,5-dimethyl-1,2,4-triazol-1-yl)propyl]-6-methyl-2-oxo-1H-pyridine-3-carboxamide (PubChem CID 56718919) has the molecular formula C14H19N5O2 and a molecular weight of 289.34 g/mol. Its IUPAC name is N-[3-(3,5-dimethyl-1,2,4-triazol-1-yl)propyl]-6-methyl-2-oxo-1H-pyridine-3-carboxamide.
| Compound Name | N-[3-(3,5-dimethyl-1,2,4-triazol-1-yl)propyl]-6-methyl-2-oxo-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 56718919 |
| Molecular Formula | C14H19N5O2 |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | N-[3-(3,5-dimethyl-1,2,4-triazol-1-yl)propyl]-6-methyl-2-oxo-1H-pyridine-3-carboxamide |
| SMILES | Cc1nc(C)n(CCCNC(=O)c2ccc(C)[nH]c2=O)n1 |
| InChI | InChI=1S/C14H19N5O2/c1-9-5-6-12(14(21)16-9)13(20)15-7-4-8-19-11(3)17-10(2)18-19/h5-6H,4,7-8H2,1-3H3,(H,15,20)(H,16,21) |
| InChIKey | CTILFIAAWKTTLR-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 92.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|