C19H22N4O2S — CID 56718994
1-(1,3-benzodioxol-5-yl)-N-(1-imidazo[2,1-b][1,3]thiazol-6-ylethyl)piperidin-4-amine (PubChem CID 56718994) has the molecular formula C19H22N4O2S and a molecular weight of 370.48 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-N-(1-imidazo[2,1-b][1,3]thiazol-6-ylethyl)piperidin-4-amine.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-N-(1-imidazo[2,1-b][1,3]thiazol-6-ylethyl)piperidin-4-amine |
|---|---|
| PubChem CID | 56718994 |
| Molecular Formula | C19H22N4O2S |
| Molecular Weight | 370.48 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-N-(1-imidazo[2,1-b][1,3]thiazol-6-ylethyl)piperidin-4-amine |
| SMILES | CC(NC1CCN(c2ccc3c(c2)OCO3)CC1)c1cn2ccsc2n1 |
| InChI | InChI=1S/C19H22N4O2S/c1-13(16-11-23-8-9-26-19(23)21-16)20-14-4-6-22(7-5-14)15-2-3-17-18(10-15)25-12-24-17/h2-3,8-11,13-14,20H,4-7,12H2,1H3 |
| InChIKey | DRZCJFRTJBFIPH-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 51.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.48 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|