About N-(1-imidazo[2,1-b][1,3]thiazol-6-ylethyl)-3-azaspiro[5.5]undecan-9-amine
N-(1-imidazo[2,1-b][1,3]thiazol-6-ylethyl)-3-azaspiro[5.5]undecan-9-amine (PubChem CID 56719293) has the molecular formula C17H26N4S
and a molecular weight of 318.49 g/mol. Its IUPAC name is N-(1-imidazo[2,1-b][1,3]thiazol-6-ylethyl)-3-azaspiro[5.5]undecan-9-amine.
Molecular Properties
| Compound Name | N-(1-imidazo[2,1-b][1,3]thiazol-6-ylethyl)-3-azaspiro[5.5]undecan-9-amine |
| PubChem CID | 56719293 |
| Molecular Formula | C17H26N4S |
| Molecular Weight | 318.49 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | N-(1-imidazo[2,1-b][1,3]thiazol-6-ylethyl)-3-azaspiro[5.5]undecan-9-amine |
| SMILES | CC(NC1CCC2(CCNCC2)CC1)c1cn2ccsc2n1 |
| InChI | InChI=1S/C17H26N4S/c1-13(15-12-21-10-11-22-16(21)20-15)19-14-2-4-17(5-3-14)6-8-18-9-7-17/h10-14,18-19H,2-9H2,1H3 |
| InChIKey | GNLUFFGGIFQFJC-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 41.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.49 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(1-imidazo[2,1-b][1,3]thiazol-6-ylethyl)-3-azaspiro[5.5]undecan-9-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-imidazo[2,1-b][1,3]thiazol-6-ylethyl)-3-azaspiro[5.5]undecan-9-amine?
The IUPAC name of N-(1-imidazo[2,1-b][1,3]thiazol-6-ylethyl)-3-azaspiro[5.5]undecan-9-amine (CID 56719293) is N-(1-imidazo[2,1-b][1,3]thiazol-6-ylethyl)-3-azaspiro[5.5]undecan-9-amine.
What is the SMILES notation for N-(1-imidazo[2,1-b][1,3]thiazol-6-ylethyl)-3-azaspiro[5.5]undecan-9-amine?
The canonical SMILES for N-(1-imidazo[2,1-b][1,3]thiazol-6-ylethyl)-3-azaspiro[5.5]undecan-9-amine is CC(NC1CCC2(CCNCC2)CC1)c1cn2ccsc2n1.
What is the InChIKey of N-(1-imidazo[2,1-b][1,3]thiazol-6-ylethyl)-3-azaspiro[5.5]undecan-9-amine?
The InChIKey is GNLUFFGGIFQFJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26N4S/c1-13(15-12-21-10-11-22-16(21)20-15)19-14-2-4-17(5-3-14)6-8-18-9-7-17/h10-14,18-19H,2-9H2,1H3.
What are the key properties of N-(1-imidazo[2,1-b][1,3]thiazol-6-ylethyl)-3-azaspiro[5.5]undecan-9-amine?
N-(1-imidazo[2,1-b][1,3]thiazol-6-ylethyl)-3-azaspiro[5.5]undecan-9-amine has a molecular weight of 318.49 g/mol, XLogP of 3.36, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-imidazo[2,1-b][1,3]thiazol-6-ylethyl)-3-azaspiro[5.5]undecan-9-amine is sourced from PubChem (CID 56719293), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).