About 3-amino-1-[(3,5-dimethyl-1-benzofuran-2-yl)methyl]pyrrolidine-3-carboxylic acid
3-amino-1-[(3,5-dimethyl-1-benzofuran-2-yl)methyl]pyrrolidine-3-carboxylic acid (PubChem CID 56720684) has the molecular formula C16H20N2O3
and a molecular weight of 288.35 g/mol. Its IUPAC name is 3-amino-1-[(3,5-dimethyl-1-benzofuran-2-yl)methyl]pyrrolidine-3-carboxylic acid.
Molecular Properties
| Compound Name | 3-amino-1-[(3,5-dimethyl-1-benzofuran-2-yl)methyl]pyrrolidine-3-carboxylic acid |
| PubChem CID | 56720684 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | 3-amino-1-[(3,5-dimethyl-1-benzofuran-2-yl)methyl]pyrrolidine-3-carboxylic acid |
| SMILES | Cc1ccc2oc(CN3CCC(N)(C(=O)O)C3)c(C)c2c1 |
| InChI | InChI=1S/C16H20N2O3/c1-10-3-4-13-12(7-10)11(2)14(21-13)8-18-6-5-16(17,9-18)15(19)20/h3-4,7H,5-6,8-9,17H2,1-2H3,(H,19,20) |
| InChIKey | BKUQDSVQYZHOIA-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 79.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-amino-1-[(3,5-dimethyl-1-benzofuran-2-yl)methyl]pyrrolidine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-1-[(3,5-dimethyl-1-benzofuran-2-yl)methyl]pyrrolidine-3-carboxylic acid?
The IUPAC name of 3-amino-1-[(3,5-dimethyl-1-benzofuran-2-yl)methyl]pyrrolidine-3-carboxylic acid (CID 56720684) is 3-amino-1-[(3,5-dimethyl-1-benzofuran-2-yl)methyl]pyrrolidine-3-carboxylic acid.
What is the SMILES notation for 3-amino-1-[(3,5-dimethyl-1-benzofuran-2-yl)methyl]pyrrolidine-3-carboxylic acid?
The canonical SMILES for 3-amino-1-[(3,5-dimethyl-1-benzofuran-2-yl)methyl]pyrrolidine-3-carboxylic acid is Cc1ccc2oc(CN3CCC(N)(C(=O)O)C3)c(C)c2c1.
What is the InChIKey of 3-amino-1-[(3,5-dimethyl-1-benzofuran-2-yl)methyl]pyrrolidine-3-carboxylic acid?
The InChIKey is BKUQDSVQYZHOIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20N2O3/c1-10-3-4-13-12(7-10)11(2)14(21-13)8-18-6-5-16(17,9-18)15(19)20/h3-4,7H,5-6,8-9,17H2,1-2H3,(H,19,20).
What are the key properties of 3-amino-1-[(3,5-dimethyl-1-benzofuran-2-yl)methyl]pyrrolidine-3-carboxylic acid?
3-amino-1-[(3,5-dimethyl-1-benzofuran-2-yl)methyl]pyrrolidine-3-carboxylic acid has a molecular weight of 288.35 g/mol, XLogP of 2.04, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-1-[(3,5-dimethyl-1-benzofuran-2-yl)methyl]pyrrolidine-3-carboxylic acid is sourced from PubChem (CID 56720684), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).