About 4'-ethenylspiro[1,3-dioxolane-2,7'-bicyclo[3.3.1]nonane]-2'-one
4'-ethenylspiro[1,3-dioxolane-2,7'-bicyclo[3.3.1]nonane]-2'-one (PubChem CID 567222) has the molecular formula C13H18O3
and a molecular weight of 222.28 g/mol. Its IUPAC name is 4'-ethenylspiro[1,3-dioxolane-2,7'-bicyclo[3.3.1]nonane]-2'-one.
Molecular Properties
| Compound Name | 4'-ethenylspiro[1,3-dioxolane-2,7'-bicyclo[3.3.1]nonane]-2'-one |
| PubChem CID | 567222 |
| Molecular Formula | C13H18O3 |
| Molecular Weight | 222.28 g/mol |
| Exact Mass | 222.13 |
| IUPAC Name | 4'-ethenylspiro[1,3-dioxolane-2,7'-bicyclo[3.3.1]nonane]-2'-one |
| SMILES | C=CC1CC(=O)C2CC1CC1(C2)OCCO1 |
| InChI | InChI=1S/C13H18O3/c1-2-9-6-12(14)11-5-10(9)7-13(8-11)15-3-4-16-13/h2,9-11H,1,3-8H2 |
| InChIKey | CHFUQOCHJPHLFT-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.28 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4'-ethenylspiro[1,3-dioxolane-2,7'-bicyclo[3.3.1]nonane]-2'-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4'-ethenylspiro[1,3-dioxolane-2,7'-bicyclo[3.3.1]nonane]-2'-one?
The IUPAC name of 4'-ethenylspiro[1,3-dioxolane-2,7'-bicyclo[3.3.1]nonane]-2'-one (CID 567222) is 4'-ethenylspiro[1,3-dioxolane-2,7'-bicyclo[3.3.1]nonane]-2'-one.
What is the SMILES notation for 4'-ethenylspiro[1,3-dioxolane-2,7'-bicyclo[3.3.1]nonane]-2'-one?
The canonical SMILES for 4'-ethenylspiro[1,3-dioxolane-2,7'-bicyclo[3.3.1]nonane]-2'-one is C=CC1CC(=O)C2CC1CC1(C2)OCCO1.
What is the InChIKey of 4'-ethenylspiro[1,3-dioxolane-2,7'-bicyclo[3.3.1]nonane]-2'-one?
The InChIKey is CHFUQOCHJPHLFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O3/c1-2-9-6-12(14)11-5-10(9)7-13(8-11)15-3-4-16-13/h2,9-11H,1,3-8H2.
What are the key properties of 4'-ethenylspiro[1,3-dioxolane-2,7'-bicyclo[3.3.1]nonane]-2'-one?
4'-ethenylspiro[1,3-dioxolane-2,7'-bicyclo[3.3.1]nonane]-2'-one has a molecular weight of 222.28 g/mol, XLogP of 1.92, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4'-ethenylspiro[1,3-dioxolane-2,7'-bicyclo[3.3.1]nonane]-2'-one is sourced from PubChem (CID 567222), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).