C13H23N5O2 — CID 56722227
4-(4-ethyl-5-oxo-3-piperidin-3-yl-1,2,4-triazol-1-yl)butanamide (PubChem CID 56722227) has the molecular formula C13H23N5O2 and a molecular weight of 281.36 g/mol. Its IUPAC name is 4-(4-ethyl-5-oxo-3-piperidin-3-yl-1,2,4-triazol-1-yl)butanamide.
| Compound Name | 4-(4-ethyl-5-oxo-3-piperidin-3-yl-1,2,4-triazol-1-yl)butanamide |
|---|---|
| PubChem CID | 56722227 |
| Molecular Formula | C13H23N5O2 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.19 |
| IUPAC Name | 4-(4-ethyl-5-oxo-3-piperidin-3-yl-1,2,4-triazol-1-yl)butanamide |
| SMILES | CCn1c(C2CCCNC2)nn(CCCC(N)=O)c1=O |
| InChI | InChI=1S/C13H23N5O2/c1-2-17-12(10-5-3-7-15-9-10)16-18(13(17)20)8-4-6-11(14)19/h10,15H,2-9H2,1H3,(H2,14,19) |
| InChIKey | HMZDXCRLGLKYBM-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 94.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |