About (2-amino-4-phenyl-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl)-(5-chlorothiophen-2-yl)methanone
(2-amino-4-phenyl-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl)-(5-chlorothiophen-2-yl)methanone (PubChem CID 56722275) has the molecular formula C17H13ClN4OS
and a molecular weight of 356.84 g/mol. Its IUPAC name is (2-amino-4-phenyl-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl)-(5-chlorothiophen-2-yl)methanone.
Molecular Properties
| Compound Name | (2-amino-4-phenyl-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl)-(5-chlorothiophen-2-yl)methanone |
| PubChem CID | 56722275 |
| Molecular Formula | C17H13ClN4OS |
| Molecular Weight | 356.84 g/mol |
| Exact Mass | 356.05 |
| IUPAC Name | (2-amino-4-phenyl-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl)-(5-chlorothiophen-2-yl)methanone |
| SMILES | Nc1nc2c(c(-c3ccccc3)n1)CN(C(=O)c1ccc(Cl)s1)C2 |
| InChI | InChI=1S/C17H13ClN4OS/c18-14-7-6-13(24-14)16(23)22-8-11-12(9-22)20-17(19)21-15(11)10-4-2-1-3-5-10/h1-7H,8-9H2,(H2,19,20,21) |
| InChIKey | XAPLPTNXJSZFCN-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.84 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2-amino-4-phenyl-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl)-(5-chlorothiophen-2-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-amino-4-phenyl-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl)-(5-chlorothiophen-2-yl)methanone?
The IUPAC name of (2-amino-4-phenyl-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl)-(5-chlorothiophen-2-yl)methanone (CID 56722275) is (2-amino-4-phenyl-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl)-(5-chlorothiophen-2-yl)methanone.
What is the SMILES notation for (2-amino-4-phenyl-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl)-(5-chlorothiophen-2-yl)methanone?
The canonical SMILES for (2-amino-4-phenyl-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl)-(5-chlorothiophen-2-yl)methanone is Nc1nc2c(c(-c3ccccc3)n1)CN(C(=O)c1ccc(Cl)s1)C2.
What is the InChIKey of (2-amino-4-phenyl-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl)-(5-chlorothiophen-2-yl)methanone?
The InChIKey is XAPLPTNXJSZFCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13ClN4OS/c18-14-7-6-13(24-14)16(23)22-8-11-12(9-22)20-17(19)21-15(11)10-4-2-1-3-5-10/h1-7H,8-9H2,(H2,19,20,21).
What are the key properties of (2-amino-4-phenyl-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl)-(5-chlorothiophen-2-yl)methanone?
(2-amino-4-phenyl-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl)-(5-chlorothiophen-2-yl)methanone has a molecular weight of 356.84 g/mol, XLogP of 3.60, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-amino-4-phenyl-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl)-(5-chlorothiophen-2-yl)methanone is sourced from PubChem (CID 56722275), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).