About spiro[1,3-dioxolane-2,6'-bicyclo[3.3.1]non-2-ene]
spiro[1,3-dioxolane-2,6'-bicyclo[3.3.1]non-2-ene] (PubChem CID 567224) has the molecular formula C11H16O2
and a molecular weight of 180.25 g/mol. Its IUPAC name is spiro[1,3-dioxolane-2,6'-bicyclo[3.3.1]non-2-ene].
Molecular Properties
| Compound Name | spiro[1,3-dioxolane-2,6'-bicyclo[3.3.1]non-2-ene] |
| PubChem CID | 567224 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | spiro[1,3-dioxolane-2,6'-bicyclo[3.3.1]non-2-ene] |
| SMILES | C1=CC2CCC3(OCCO3)C(C1)C2 |
| InChI | InChI=1S/C11H16O2/c1-2-9-4-5-11(10(3-1)8-9)12-6-7-13-11/h1-2,9-10H,3-8H2 |
| InChIKey | XQNQSRWPSDKSJV-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze spiro[1,3-dioxolane-2,6'-bicyclo[3.3.1]non-2-ene] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[1,3-dioxolane-2,6'-bicyclo[3.3.1]non-2-ene]?
The IUPAC name of spiro[1,3-dioxolane-2,6'-bicyclo[3.3.1]non-2-ene] (CID 567224) is spiro[1,3-dioxolane-2,6'-bicyclo[3.3.1]non-2-ene].
What is the SMILES notation for spiro[1,3-dioxolane-2,6'-bicyclo[3.3.1]non-2-ene]?
The canonical SMILES for spiro[1,3-dioxolane-2,6'-bicyclo[3.3.1]non-2-ene] is C1=CC2CCC3(OCCO3)C(C1)C2.
What is the InChIKey of spiro[1,3-dioxolane-2,6'-bicyclo[3.3.1]non-2-ene]?
The InChIKey is XQNQSRWPSDKSJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O2/c1-2-9-4-5-11(10(3-1)8-9)12-6-7-13-11/h1-2,9-10H,3-8H2.
What are the key properties of spiro[1,3-dioxolane-2,6'-bicyclo[3.3.1]non-2-ene]?
spiro[1,3-dioxolane-2,6'-bicyclo[3.3.1]non-2-ene] has a molecular weight of 180.25 g/mol, XLogP of 2.11, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[1,3-dioxolane-2,6'-bicyclo[3.3.1]non-2-ene] is sourced from PubChem (CID 567224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).