C13H21N5O — CID 56722828
N-methyl-N-[(5-methyl-1H-imidazol-2-yl)methyl]-2,3,4,5,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-3a-carboxamide (PubChem CID 56722828) has the molecular formula C13H21N5O and a molecular weight of 263.34 g/mol. Its IUPAC name is N-methyl-N-[(5-methyl-1H-imidazol-2-yl)methyl]-2,3,4,5,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-3a-carboxamide.
| Compound Name | N-methyl-N-[(5-methyl-1H-imidazol-2-yl)methyl]-2,3,4,5,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-3a-carboxamide |
|---|---|
| PubChem CID | 56722828 |
| Molecular Formula | C13H21N5O |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | N-methyl-N-[(5-methyl-1H-imidazol-2-yl)methyl]-2,3,4,5,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-3a-carboxamide |
| SMILES | Cc1cnc(CN(C)C(=O)C23CNCC2CNC3)[nH]1 |
| InChI | InChI=1S/C13H21N5O/c1-9-3-16-11(17-9)6-18(2)12(19)13-7-14-4-10(13)5-15-8-13/h3,10,14-15H,4-8H2,1-2H3,(H,16,17) |
| InChIKey | XVZQEYRLZGDKMS-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |