C23H29N3O — CID 56723400
4-[9-(3,6-dihydro-2H-pyridin-1-yl)-3-azaspiro[5.5]undecane-3-carbonyl]benzonitrile (PubChem CID 56723400) has the molecular formula C23H29N3O and a molecular weight of 363.50 g/mol. Its IUPAC name is 4-[9-(3,6-dihydro-2H-pyridin-1-yl)-3-azaspiro[5.5]undecane-3-carbonyl]benzonitrile.
| Compound Name | 4-[9-(3,6-dihydro-2H-pyridin-1-yl)-3-azaspiro[5.5]undecane-3-carbonyl]benzonitrile |
|---|---|
| PubChem CID | 56723400 |
| Molecular Formula | C23H29N3O |
| Molecular Weight | 363.50 g/mol |
| Exact Mass | 363.23 |
| IUPAC Name | 4-[9-(3,6-dihydro-2H-pyridin-1-yl)-3-azaspiro[5.5]undecane-3-carbonyl]benzonitrile |
| SMILES | N#Cc1ccc(C(=O)N2CCC3(CCC(N4CC=CCC4)CC3)CC2)cc1 |
| InChI | InChI=1S/C23H29N3O/c24-18-19-4-6-20(7-5-19)22(27)26-16-12-23(13-17-26)10-8-21(9-11-23)25-14-2-1-3-15-25/h1-2,4-7,21H,3,8-17H2 |
| InChIKey | LRASUSKOKSSWCL-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 47.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.50 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|