C16H24N4O2S — CID 56723496
5-ethyl-3-[(2-ethyl-1,3-thiazol-4-yl)methyl]-5-piperidin-4-ylimidazolidine-2,4-dione (PubChem CID 56723496) has the molecular formula C16H24N4O2S and a molecular weight of 336.46 g/mol. Its IUPAC name is 5-ethyl-3-[(2-ethyl-1,3-thiazol-4-yl)methyl]-5-piperidin-4-ylimidazolidine-2,4-dione.
| Compound Name | 5-ethyl-3-[(2-ethyl-1,3-thiazol-4-yl)methyl]-5-piperidin-4-ylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 56723496 |
| Molecular Formula | C16H24N4O2S |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | 5-ethyl-3-[(2-ethyl-1,3-thiazol-4-yl)methyl]-5-piperidin-4-ylimidazolidine-2,4-dione |
| SMILES | CCc1nc(CN2C(=O)NC(CC)(C3CCNCC3)C2=O)cs1 |
| InChI | InChI=1S/C16H24N4O2S/c1-3-13-18-12(10-23-13)9-20-14(21)16(4-2,19-15(20)22)11-5-7-17-8-6-11/h10-11,17H,3-9H2,1-2H3,(H,19,22) |
| InChIKey | UNNBZCULVODPOL-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|