C21H24FN3O3 — CID 56723883
2-[2-[(4aS,8aS)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-2-oxoethyl]-6-(4-fluorophenyl)pyridazin-3-one (PubChem CID 56723883) has the molecular formula C21H24FN3O3 and a molecular weight of 385.44 g/mol. Its IUPAC name is 2-[2-[(4aS,8aS)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-2-oxoethyl]-6-(4-fluorophenyl)pyridazin-3-one.
| Compound Name | 2-[2-[(4aS,8aS)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-2-oxoethyl]-6-(4-fluorophenyl)pyridazin-3-one |
|---|---|
| PubChem CID | 56723883 |
| Molecular Formula | C21H24FN3O3 |
| Molecular Weight | 385.44 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | 2-[2-[(4aS,8aS)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-2-oxoethyl]-6-(4-fluorophenyl)pyridazin-3-one |
| SMILES | O=C(Cn1nc(-c2ccc(F)cc2)ccc1=O)N1CC[C@@]2(O)CCCC[C@H]2C1 |
| InChI | InChI=1S/C21H24FN3O3/c22-17-6-4-15(5-7-17)18-8-9-19(26)25(23-18)14-20(27)24-12-11-21(28)10-2-1-3-16(21)13-24/h4-9,16,28H,1-3,10-14H2/t16-,21-/m0/s1 |
| InChIKey | NLJMKDZNLHQVPW-KKSFZXQISA-N |
| XLogP | 2.20 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.44 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |