About 2-phenacyl-[1,2,4]triazolo[4,3-a]pyrimidin-3-one
2-phenacyl-[1,2,4]triazolo[4,3-a]pyrimidin-3-one (PubChem CID 56724937) has the molecular formula C13H10N4O2
and a molecular weight of 254.25 g/mol. Its IUPAC name is 2-phenacyl-[1,2,4]triazolo[4,3-a]pyrimidin-3-one.
Molecular Properties
| Compound Name | 2-phenacyl-[1,2,4]triazolo[4,3-a]pyrimidin-3-one |
| PubChem CID | 56724937 |
| Molecular Formula | C13H10N4O2 |
| Molecular Weight | 254.25 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | 2-phenacyl-[1,2,4]triazolo[4,3-a]pyrimidin-3-one |
| SMILES | O=C(Cn1nc2ncccn2c1=O)c1ccccc1 |
| InChI | InChI=1S/C13H10N4O2/c18-11(10-5-2-1-3-6-10)9-17-13(19)16-8-4-7-14-12(16)15-17/h1-8H,9H2 |
| InChIKey | PRUPJZPAPAXZCJ-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 69.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.25 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-phenacyl-[1,2,4]triazolo[4,3-a]pyrimidin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenacyl-[1,2,4]triazolo[4,3-a]pyrimidin-3-one?
The IUPAC name of 2-phenacyl-[1,2,4]triazolo[4,3-a]pyrimidin-3-one (CID 56724937) is 2-phenacyl-[1,2,4]triazolo[4,3-a]pyrimidin-3-one.
What is the SMILES notation for 2-phenacyl-[1,2,4]triazolo[4,3-a]pyrimidin-3-one?
The canonical SMILES for 2-phenacyl-[1,2,4]triazolo[4,3-a]pyrimidin-3-one is O=C(Cn1nc2ncccn2c1=O)c1ccccc1.
What is the InChIKey of 2-phenacyl-[1,2,4]triazolo[4,3-a]pyrimidin-3-one?
The InChIKey is PRUPJZPAPAXZCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10N4O2/c18-11(10-5-2-1-3-6-10)9-17-13(19)16-8-4-7-14-12(16)15-17/h1-8H,9H2.
What are the key properties of 2-phenacyl-[1,2,4]triazolo[4,3-a]pyrimidin-3-one?
2-phenacyl-[1,2,4]triazolo[4,3-a]pyrimidin-3-one has a molecular weight of 254.25 g/mol, XLogP of 0.77, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenacyl-[1,2,4]triazolo[4,3-a]pyrimidin-3-one is sourced from PubChem (CID 56724937), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).