C25H26N4O3S2 — CID 56725632
1-(1,1-dioxothiolan-3-yl)-2-methyl-N-(3-phenylpropyl)-6-thiophen-2-ylimidazo[4,5-c]pyridine-4-carboxamide (PubChem CID 56725632) has the molecular formula C25H26N4O3S2 and a molecular weight of 494.64 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-2-methyl-N-(3-phenylpropyl)-6-thiophen-2-ylimidazo[4,5-c]pyridine-4-carboxamide.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-2-methyl-N-(3-phenylpropyl)-6-thiophen-2-ylimidazo[4,5-c]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 56725632 |
| Molecular Formula | C25H26N4O3S2 |
| Molecular Weight | 494.64 g/mol |
| Exact Mass | 494.14 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-2-methyl-N-(3-phenylpropyl)-6-thiophen-2-ylimidazo[4,5-c]pyridine-4-carboxamide |
| SMILES | Cc1nc2c(C(=O)NCCCc3ccccc3)nc(-c3cccs3)cc2n1C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C25H26N4O3S2/c1-17-27-23-21(29(17)19-11-14-34(31,32)16-19)15-20(22-10-6-13-33-22)28-24(23)25(30)26-12-5-9-18-7-3-2-4-8-18/h2-4,6-8,10,13,15,19H,5,9,11-12,14,16H2,1H3,(H,26,30) |
| InChIKey | TWYUEVMSUGZPBB-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 93.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.64 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|