About 3-benzyl-N-phenyl-4-thiophen-2-yl-1,3-thiazol-2-imine;hydrobromide
3-benzyl-N-phenyl-4-thiophen-2-yl-1,3-thiazol-2-imine;hydrobromide (PubChem CID 56726121) has the molecular formula C20H17BrN2S2
and a molecular weight of 429.41 g/mol. Its IUPAC name is 3-benzyl-N-phenyl-4-thiophen-2-yl-1,3-thiazol-2-imine;hydrobromide.
Molecular Properties
| Compound Name | 3-benzyl-N-phenyl-4-thiophen-2-yl-1,3-thiazol-2-imine;hydrobromide |
| PubChem CID | 56726121 |
| Molecular Formula | C20H17BrN2S2 |
| Molecular Weight | 429.41 g/mol |
| Exact Mass | 428.00 |
| IUPAC Name | 3-benzyl-N-phenyl-4-thiophen-2-yl-1,3-thiazol-2-imine;hydrobromide |
| SMILES | Br.c1ccc(Cn2c(-c3cccs3)cs/c2=N\c2ccccc2)cc1 |
| InChI | InChI=1S/C20H16N2S2.BrH/c1-3-8-16(9-4-1)14-22-18(19-12-7-13-23-19)15-24-20(22)21-17-10-5-2-6-11-17;/h1-13,15H,14H2;1H/b21-20-; |
| InChIKey | BYYCKBHEWDYWNX-CFRCJOIHSA-N |
| XLogP | 6.14 |
| TPSA | 17.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 429.41 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|
Analyze 3-benzyl-N-phenyl-4-thiophen-2-yl-1,3-thiazol-2-imine;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-benzyl-N-phenyl-4-thiophen-2-yl-1,3-thiazol-2-imine;hydrobromide?
The IUPAC name of 3-benzyl-N-phenyl-4-thiophen-2-yl-1,3-thiazol-2-imine;hydrobromide (CID 56726121) is 3-benzyl-N-phenyl-4-thiophen-2-yl-1,3-thiazol-2-imine;hydrobromide.
What is the SMILES notation for 3-benzyl-N-phenyl-4-thiophen-2-yl-1,3-thiazol-2-imine;hydrobromide?
The canonical SMILES for 3-benzyl-N-phenyl-4-thiophen-2-yl-1,3-thiazol-2-imine;hydrobromide is Br.c1ccc(Cn2c(-c3cccs3)cs/c2=N\c2ccccc2)cc1.
What is the InChIKey of 3-benzyl-N-phenyl-4-thiophen-2-yl-1,3-thiazol-2-imine;hydrobromide?
The InChIKey is BYYCKBHEWDYWNX-CFRCJOIHSA-N. The full InChI is InChI=1S/C20H16N2S2.BrH/c1-3-8-16(9-4-1)14-22-18(19-12-7-13-23-19)15-24-20(22)21-17-10-5-2-6-11-17;/h1-13,15H,14H2;1H/b21-20-;.
What are the key properties of 3-benzyl-N-phenyl-4-thiophen-2-yl-1,3-thiazol-2-imine;hydrobromide?
3-benzyl-N-phenyl-4-thiophen-2-yl-1,3-thiazol-2-imine;hydrobromide has a molecular weight of 429.41 g/mol, XLogP of 6.14, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzyl-N-phenyl-4-thiophen-2-yl-1,3-thiazol-2-imine;hydrobromide is sourced from PubChem (CID 56726121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).