C24H21N5O5S2 — CID 56726971
(6Z)-5-imino-6-[[1-[2-(3-methoxyphenoxy)ethyl]indol-3-yl]methylidene]-2-methylsulfonyl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one (PubChem CID 56726971) has the molecular formula C24H21N5O5S2 and a molecular weight of 523.60 g/mol. Its IUPAC name is (6Z)-5-imino-6-[[1-[2-(3-methoxyphenoxy)ethyl]indol-3-yl]methylidene]-2-methylsulfonyl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one.
| Compound Name | (6Z)-5-imino-6-[[1-[2-(3-methoxyphenoxy)ethyl]indol-3-yl]methylidene]-2-methylsulfonyl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 56726971 |
| Molecular Formula | C24H21N5O5S2 |
| Molecular Weight | 523.60 g/mol |
| Exact Mass | 523.10 |
| IUPAC Name | (6Z)-5-imino-6-[[1-[2-(3-methoxyphenoxy)ethyl]indol-3-yl]methylidene]-2-methylsulfonyl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
| SMILES | [H]/N=C1C(=C/c2cn(CCOc3cccc(OC)c3)c3ccccc23)/C(=O)N=C2SC(S(C)(=O)=O)=NN2/1 |
| InChI | InChI=1S/C24H21N5O5S2/c1-33-16-6-5-7-17(13-16)34-11-10-28-14-15(18-8-3-4-9-20(18)28)12-19-21(25)29-23(26-22(19)30)35-24(27-29)36(2,31)32/h3-9,12-14,25H,10-11H2,1-2H3/b19-12-,25-21- |
| InChIKey | ZUVOBHUQOOLOQH-XEZWARCSSA-N |
| XLogP | 3.35 |
| TPSA | 126.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.60 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|