C27H22N2O7S2 — CID 56727907
[2-ethoxy-4-[(Z)-[3-(4-ethoxyphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenyl] 3-nitrobenzoate (PubChem CID 56727907) has the molecular formula C27H22N2O7S2 and a molecular weight of 550.61 g/mol. Its IUPAC name is [2-ethoxy-4-[(Z)-[3-(4-ethoxyphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenyl] 3-nitrobenzoate.
| Compound Name | [2-ethoxy-4-[(Z)-[3-(4-ethoxyphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenyl] 3-nitrobenzoate |
|---|---|
| PubChem CID | 56727907 |
| Molecular Formula | C27H22N2O7S2 |
| Molecular Weight | 550.61 g/mol |
| Exact Mass | 550.09 |
| IUPAC Name | [2-ethoxy-4-[(Z)-[3-(4-ethoxyphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenyl] 3-nitrobenzoate |
| SMILES | CCOc1ccc(N2C(=O)/C(=C/c3ccc(OC(=O)c4cccc([N+](=O)[O-])c4)c(OCC)c3)SC2=S)cc1 |
| InChI | InChI=1S/C27H22N2O7S2/c1-3-34-21-11-9-19(10-12-21)28-25(30)24(38-27(28)37)15-17-8-13-22(23(14-17)35-4-2)36-26(31)18-6-5-7-20(16-18)29(32)33/h5-16H,3-4H2,1-2H3/b24-15- |
| InChIKey | VWWHKHGESUJJOU-IWIPYMOSSA-N |
| XLogP | 6.02 |
| TPSA | 108.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.61 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|