About [2-(3-ethyl-1,2,4-oxadiazol-5-yl)piperidin-1-yl]-thiophen-2-ylmethanone
[2-(3-ethyl-1,2,4-oxadiazol-5-yl)piperidin-1-yl]-thiophen-2-ylmethanone (PubChem CID 56728135) has the molecular formula C14H17N3O2S
and a molecular weight of 291.38 g/mol. Its IUPAC name is [2-(3-ethyl-1,2,4-oxadiazol-5-yl)piperidin-1-yl]-thiophen-2-ylmethanone.
Molecular Properties
| Compound Name | [2-(3-ethyl-1,2,4-oxadiazol-5-yl)piperidin-1-yl]-thiophen-2-ylmethanone |
| PubChem CID | 56728135 |
| Molecular Formula | C14H17N3O2S |
| Molecular Weight | 291.38 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | [2-(3-ethyl-1,2,4-oxadiazol-5-yl)piperidin-1-yl]-thiophen-2-ylmethanone |
| SMILES | CCc1noc(C2CCCCN2C(=O)c2cccs2)n1 |
| InChI | InChI=1S/C14H17N3O2S/c1-2-12-15-13(19-16-12)10-6-3-4-8-17(10)14(18)11-7-5-9-20-11/h5,7,9-10H,2-4,6,8H2,1H3 |
| InChIKey | QVJPHEROIDHVEK-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 59.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.38 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-(3-ethyl-1,2,4-oxadiazol-5-yl)piperidin-1-yl]-thiophen-2-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(3-ethyl-1,2,4-oxadiazol-5-yl)piperidin-1-yl]-thiophen-2-ylmethanone?
The IUPAC name of [2-(3-ethyl-1,2,4-oxadiazol-5-yl)piperidin-1-yl]-thiophen-2-ylmethanone (CID 56728135) is [2-(3-ethyl-1,2,4-oxadiazol-5-yl)piperidin-1-yl]-thiophen-2-ylmethanone.
What is the SMILES notation for [2-(3-ethyl-1,2,4-oxadiazol-5-yl)piperidin-1-yl]-thiophen-2-ylmethanone?
The canonical SMILES for [2-(3-ethyl-1,2,4-oxadiazol-5-yl)piperidin-1-yl]-thiophen-2-ylmethanone is CCc1noc(C2CCCCN2C(=O)c2cccs2)n1.
What is the InChIKey of [2-(3-ethyl-1,2,4-oxadiazol-5-yl)piperidin-1-yl]-thiophen-2-ylmethanone?
The InChIKey is QVJPHEROIDHVEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17N3O2S/c1-2-12-15-13(19-16-12)10-6-3-4-8-17(10)14(18)11-7-5-9-20-11/h5,7,9-10H,2-4,6,8H2,1H3.
What are the key properties of [2-(3-ethyl-1,2,4-oxadiazol-5-yl)piperidin-1-yl]-thiophen-2-ylmethanone?
[2-(3-ethyl-1,2,4-oxadiazol-5-yl)piperidin-1-yl]-thiophen-2-ylmethanone has a molecular weight of 291.38 g/mol, XLogP of 3.06, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(3-ethyl-1,2,4-oxadiazol-5-yl)piperidin-1-yl]-thiophen-2-ylmethanone is sourced from PubChem (CID 56728135), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).