C12H11BF6O8 — CID 567290
[2-(2-ethyl-1,3,2-dioxaborolan-4-yl)-5-oxo-4-(2,2,2-trifluoroacetyl)oxyoxolan-3-yl] 2,2,2-trifluoroacetate (PubChem CID 567290) has the molecular formula C12H11BF6O8 and a molecular weight of 408.01 g/mol. Its IUPAC name is [2-(2-ethyl-1,3,2-dioxaborolan-4-yl)-5-oxo-4-(2,2,2-trifluoroacetyl)oxyoxolan-3-yl] 2,2,2-trifluoroacetate.
| Compound Name | [2-(2-ethyl-1,3,2-dioxaborolan-4-yl)-5-oxo-4-(2,2,2-trifluoroacetyl)oxyoxolan-3-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 567290 |
| Molecular Formula | C12H11BF6O8 |
| Molecular Weight | 408.01 g/mol |
| Exact Mass | 408.05 |
| IUPAC Name | [2-(2-ethyl-1,3,2-dioxaborolan-4-yl)-5-oxo-4-(2,2,2-trifluoroacetyl)oxyoxolan-3-yl] 2,2,2-trifluoroacetate |
| SMILES | CCB1OCC(C2OC(=O)C(OC(=O)C(F)(F)F)C2OC(=O)C(F)(F)F)O1 |
| InChI | InChI=1S/C12H11BF6O8/c1-2-13-23-3-4(27-13)5-6(25-9(21)11(14,15)16)7(8(20)24-5)26-10(22)12(17,18)19/h4-7H,2-3H2,1H3 |
| InChIKey | RPFJESKZVGMXPF-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.01 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|