C21H20ClN3O4S — CID 56729335
2-(4-chlorophenoxy)-N-[1-(1,1-dioxothiolan-3-yl)-3-phenylpyrazol-5-yl]acetamide (PubChem CID 56729335) has the molecular formula C21H20ClN3O4S and a molecular weight of 445.93 g/mol. Its IUPAC name is 2-(4-chlorophenoxy)-N-[1-(1,1-dioxothiolan-3-yl)-3-phenylpyrazol-5-yl]acetamide.
| Compound Name | 2-(4-chlorophenoxy)-N-[1-(1,1-dioxothiolan-3-yl)-3-phenylpyrazol-5-yl]acetamide |
|---|---|
| PubChem CID | 56729335 |
| Molecular Formula | C21H20ClN3O4S |
| Molecular Weight | 445.93 g/mol |
| Exact Mass | 445.09 |
| IUPAC Name | 2-(4-chlorophenoxy)-N-[1-(1,1-dioxothiolan-3-yl)-3-phenylpyrazol-5-yl]acetamide |
| SMILES | O=C(COc1ccc(Cl)cc1)Nc1cc(-c2ccccc2)nn1C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C21H20ClN3O4S/c22-16-6-8-18(9-7-16)29-13-21(26)23-20-12-19(15-4-2-1-3-5-15)24-25(20)17-10-11-30(27,28)14-17/h1-9,12,17H,10-11,13-14H2,(H,23,26) |
| InChIKey | RPNHBLBKKSQJDZ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.93 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |