C11H11ClN2O3 — CID 56730123
6-chloro-N,2-dimethyl-3-oxo-4H-1,4-benzoxazine-2-carboxamide (PubChem CID 56730123) has the molecular formula C11H11ClN2O3 and a molecular weight of 254.67 g/mol. Its IUPAC name is 6-chloro-N,2-dimethyl-3-oxo-4H-1,4-benzoxazine-2-carboxamide.
| Compound Name | 6-chloro-N,2-dimethyl-3-oxo-4H-1,4-benzoxazine-2-carboxamide |
|---|---|
| PubChem CID | 56730123 |
| Molecular Formula | C11H11ClN2O3 |
| Molecular Weight | 254.67 g/mol |
| Exact Mass | 254.05 |
| IUPAC Name | 6-chloro-N,2-dimethyl-3-oxo-4H-1,4-benzoxazine-2-carboxamide |
| SMILES | CNC(=O)C1(C)Oc2ccc(Cl)cc2NC1=O |
| InChI | InChI=1S/C11H11ClN2O3/c1-11(9(15)13-2)10(16)14-7-5-6(12)3-4-8(7)17-11/h3-5H,1-2H3,(H,13,15)(H,14,16) |
| InChIKey | UWWRTKKZSHJEST-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.67 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|