About spiro[1,3-dioxolane-2,7'-bicyclo[4.2.0]oct-2-ene]
spiro[1,3-dioxolane-2,7'-bicyclo[4.2.0]oct-2-ene] (PubChem CID 567357) has the molecular formula C10H14O2
and a molecular weight of 166.22 g/mol. Its IUPAC name is spiro[1,3-dioxolane-2,7'-bicyclo[4.2.0]oct-2-ene].
Molecular Properties
| Compound Name | spiro[1,3-dioxolane-2,7'-bicyclo[4.2.0]oct-2-ene] |
| PubChem CID | 567357 |
| Molecular Formula | C10H14O2 |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.10 |
| IUPAC Name | spiro[1,3-dioxolane-2,7'-bicyclo[4.2.0]oct-2-ene] |
| SMILES | C1=CC2CC3(OCCO3)C2CC1 |
| InChI | InChI=1S/C10H14O2/c1-2-4-9-8(3-1)7-10(9)11-5-6-12-10/h1,3,8-9H,2,4-7H2 |
| InChIKey | HUELOGTVFHZTOL-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze spiro[1,3-dioxolane-2,7'-bicyclo[4.2.0]oct-2-ene] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[1,3-dioxolane-2,7'-bicyclo[4.2.0]oct-2-ene]?
The IUPAC name of spiro[1,3-dioxolane-2,7'-bicyclo[4.2.0]oct-2-ene] (CID 567357) is spiro[1,3-dioxolane-2,7'-bicyclo[4.2.0]oct-2-ene].
What is the SMILES notation for spiro[1,3-dioxolane-2,7'-bicyclo[4.2.0]oct-2-ene]?
The canonical SMILES for spiro[1,3-dioxolane-2,7'-bicyclo[4.2.0]oct-2-ene] is C1=CC2CC3(OCCO3)C2CC1.
What is the InChIKey of spiro[1,3-dioxolane-2,7'-bicyclo[4.2.0]oct-2-ene]?
The InChIKey is HUELOGTVFHZTOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O2/c1-2-4-9-8(3-1)7-10(9)11-5-6-12-10/h1,3,8-9H,2,4-7H2.
What are the key properties of spiro[1,3-dioxolane-2,7'-bicyclo[4.2.0]oct-2-ene]?
spiro[1,3-dioxolane-2,7'-bicyclo[4.2.0]oct-2-ene] has a molecular weight of 166.22 g/mol, XLogP of 1.72, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[1,3-dioxolane-2,7'-bicyclo[4.2.0]oct-2-ene] is sourced from PubChem (CID 567357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).