C25H36O5 — CID 567373
10',13'-dimethyl-17'-(2-methyl-1,3-dioxolan-2-yl)spiro[1,3-dioxolane-2,3'-2,4,7,8,9,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene]-11'-one (PubChem CID 567373) has the molecular formula C25H36O5 and a molecular weight of 416.56 g/mol. Its IUPAC name is 10',13'-dimethyl-17'-(2-methyl-1,3-dioxolan-2-yl)spiro[1,3-dioxolane-2,3'-2,4,7,8,9,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene]-11'-one.
| Compound Name | 10',13'-dimethyl-17'-(2-methyl-1,3-dioxolan-2-yl)spiro[1,3-dioxolane-2,3'-2,4,7,8,9,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene]-11'-one |
|---|---|
| PubChem CID | 567373 |
| Molecular Formula | C25H36O5 |
| Molecular Weight | 416.56 g/mol |
| Exact Mass | 416.26 |
| IUPAC Name | 10',13'-dimethyl-17'-(2-methyl-1,3-dioxolan-2-yl)spiro[1,3-dioxolane-2,3'-2,4,7,8,9,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene]-11'-one |
| SMILES | CC1(C2CCC3C4CC=C5CC6(CCC5(C)C4C(=O)CC32C)OCCO6)OCCO1 |
| InChI | InChI=1S/C25H36O5/c1-22-8-9-25(29-12-13-30-25)14-16(22)4-5-17-18-6-7-20(24(3)27-10-11-28-24)23(18,2)15-19(26)21(17)22/h4,17-18,20-21H,5-15H2,1-3H3 |
| InChIKey | HJMFHIVOPXIFAG-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.56 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|