C19H19ClN6O — CID 56737354
[4-[4-amino-2-(1,2,4-triazol-4-yl)phenyl]piperazin-1-yl]-(3-chlorophenyl)methanone (PubChem CID 56737354) has the molecular formula C19H19ClN6O and a molecular weight of 382.86 g/mol. Its IUPAC name is [4-[4-amino-2-(1,2,4-triazol-4-yl)phenyl]piperazin-1-yl]-(3-chlorophenyl)methanone.
| Compound Name | [4-[4-amino-2-(1,2,4-triazol-4-yl)phenyl]piperazin-1-yl]-(3-chlorophenyl)methanone |
|---|---|
| PubChem CID | 56737354 |
| Molecular Formula | C19H19ClN6O |
| Molecular Weight | 382.86 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | [4-[4-amino-2-(1,2,4-triazol-4-yl)phenyl]piperazin-1-yl]-(3-chlorophenyl)methanone |
| SMILES | Nc1ccc(N2CCN(C(=O)c3cccc(Cl)c3)CC2)c(-n2cnnc2)c1 |
| InChI | InChI=1S/C19H19ClN6O/c20-15-3-1-2-14(10-15)19(27)25-8-6-24(7-9-25)17-5-4-16(21)11-18(17)26-12-22-23-13-26/h1-5,10-13H,6-9,21H2 |
| InChIKey | AJWIEARXDFKRKF-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 80.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.86 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|