C18H28BNO2 — CID 56737722
N-[[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]cyclopentanamine (PubChem CID 56737722) has the molecular formula C18H28BNO2 and a molecular weight of 301.24 g/mol. Its IUPAC name is N-[[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]cyclopentanamine.
| Compound Name | N-[[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]cyclopentanamine |
|---|---|
| PubChem CID | 56737722 |
| Molecular Formula | C18H28BNO2 |
| Molecular Weight | 301.24 g/mol |
| Exact Mass | 301.22 |
| IUPAC Name | N-[[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]cyclopentanamine |
| SMILES | CC1(C)OB(c2cccc(CNC3CCCC3)c2)OC1(C)C |
| InChI | InChI=1S/C18H28BNO2/c1-17(2)18(3,4)22-19(21-17)15-9-7-8-14(12-15)13-20-16-10-5-6-11-16/h7-9,12,16,20H,5-6,10-11,13H2,1-4H3 |
| InChIKey | NFZVLTKESFWJHY-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.24 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|