About 4-(1H-1,2,4-triazol-5-yl)piperidine
4-(1H-1,2,4-triazol-5-yl)piperidine (PubChem CID 56737789) has the molecular formula C7H12N4
and a molecular weight of 152.20 g/mol. Its IUPAC name is 4-(1H-1,2,4-triazol-5-yl)piperidine.
Molecular Properties
| Compound Name | 4-(1H-1,2,4-triazol-5-yl)piperidine |
| PubChem CID | 56737789 |
| Molecular Formula | C7H12N4 |
| Molecular Weight | 152.20 g/mol |
| Exact Mass | 152.11 |
| IUPAC Name | 4-(1H-1,2,4-triazol-5-yl)piperidine |
| SMILES | c1n[nH]c(C2CCNCC2)n1 |
| InChI | InChI=1S/C7H12N4/c1-3-8-4-2-6(1)7-9-5-10-11-7/h5-6,8H,1-4H2,(H,9,10,11) |
| InChIKey | YPPVPNFMCXRUCC-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.20 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(1H-1,2,4-triazol-5-yl)piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1H-1,2,4-triazol-5-yl)piperidine?
The IUPAC name of 4-(1H-1,2,4-triazol-5-yl)piperidine (CID 56737789) is 4-(1H-1,2,4-triazol-5-yl)piperidine.
What is the SMILES notation for 4-(1H-1,2,4-triazol-5-yl)piperidine?
The canonical SMILES for 4-(1H-1,2,4-triazol-5-yl)piperidine is c1n[nH]c(C2CCNCC2)n1.
What is the InChIKey of 4-(1H-1,2,4-triazol-5-yl)piperidine?
The InChIKey is YPPVPNFMCXRUCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N4/c1-3-8-4-2-6(1)7-9-5-10-11-7/h5-6,8H,1-4H2,(H,9,10,11).
What are the key properties of 4-(1H-1,2,4-triazol-5-yl)piperidine?
4-(1H-1,2,4-triazol-5-yl)piperidine has a molecular weight of 152.20 g/mol, XLogP of 0.27, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1H-1,2,4-triazol-5-yl)piperidine is sourced from PubChem (CID 56737789), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).