C18H25N5O — CID 56738315
4-N-[1-(2,6-dimethylphenoxy)propan-2-yl]-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidine-2,4-diamine (PubChem CID 56738315) has the molecular formula C18H25N5O and a molecular weight of 327.43 g/mol. Its IUPAC name is 4-N-[1-(2,6-dimethylphenoxy)propan-2-yl]-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidine-2,4-diamine.
| Compound Name | 4-N-[1-(2,6-dimethylphenoxy)propan-2-yl]-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 56738315 |
| Molecular Formula | C18H25N5O |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.21 |
| IUPAC Name | 4-N-[1-(2,6-dimethylphenoxy)propan-2-yl]-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidine-2,4-diamine |
| SMILES | Cc1cccc(C)c1OCC(C)Nc1nc(N)nc2c1CCNC2 |
| InChI | InChI=1S/C18H25N5O/c1-11-5-4-6-12(2)16(11)24-10-13(3)21-17-14-7-8-20-9-15(14)22-18(19)23-17/h4-6,13,20H,7-10H2,1-3H3,(H3,19,21,22,23) |
| InChIKey | DJERMENRYNCZBU-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |