C20H28N6O — CID 56738701
2-[2-methyl-3-[[[3-methyl-1-(2-methyl-1,2,4-triazol-3-yl)butyl]amino]methyl]indol-1-yl]acetamide (PubChem CID 56738701) has the molecular formula C20H28N6O and a molecular weight of 368.49 g/mol. Its IUPAC name is 2-[2-methyl-3-[[[3-methyl-1-(2-methyl-1,2,4-triazol-3-yl)butyl]amino]methyl]indol-1-yl]acetamide.
| Compound Name | 2-[2-methyl-3-[[[3-methyl-1-(2-methyl-1,2,4-triazol-3-yl)butyl]amino]methyl]indol-1-yl]acetamide |
|---|---|
| PubChem CID | 56738701 |
| Molecular Formula | C20H28N6O |
| Molecular Weight | 368.49 g/mol |
| Exact Mass | 368.23 |
| IUPAC Name | 2-[2-methyl-3-[[[3-methyl-1-(2-methyl-1,2,4-triazol-3-yl)butyl]amino]methyl]indol-1-yl]acetamide |
| SMILES | Cc1c(CNC(CC(C)C)c2ncnn2C)c2ccccc2n1CC(N)=O |
| InChI | InChI=1S/C20H28N6O/c1-13(2)9-17(20-23-12-24-25(20)4)22-10-16-14(3)26(11-19(21)27)18-8-6-5-7-15(16)18/h5-8,12-13,17,22H,9-11H2,1-4H3,(H2,21,27) |
| InChIKey | ZLUQXSGWLQEUHF-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 90.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.49 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|