About (2-tert-butyl-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl)-(2-methoxypyrimidin-5-yl)methanone
(2-tert-butyl-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl)-(2-methoxypyrimidin-5-yl)methanone (PubChem CID 56739691) has the molecular formula C16H19N5O2
and a molecular weight of 313.36 g/mol. Its IUPAC name is (2-tert-butyl-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl)-(2-methoxypyrimidin-5-yl)methanone.
Molecular Properties
| Compound Name | (2-tert-butyl-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl)-(2-methoxypyrimidin-5-yl)methanone |
| PubChem CID | 56739691 |
| Molecular Formula | C16H19N5O2 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | (2-tert-butyl-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl)-(2-methoxypyrimidin-5-yl)methanone |
| SMILES | COc1ncc(C(=O)N2Cc3cnc(C(C)(C)C)nc3C2)cn1 |
| InChI | InChI=1S/C16H19N5O2/c1-16(2,3)14-17-7-11-8-21(9-12(11)20-14)13(22)10-5-18-15(23-4)19-6-10/h5-7H,8-9H2,1-4H3 |
| InChIKey | XVKXSLCYRRKZBN-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 81.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (2-tert-butyl-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl)-(2-methoxypyrimidin-5-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-tert-butyl-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl)-(2-methoxypyrimidin-5-yl)methanone?
The IUPAC name of (2-tert-butyl-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl)-(2-methoxypyrimidin-5-yl)methanone (CID 56739691) is (2-tert-butyl-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl)-(2-methoxypyrimidin-5-yl)methanone.
What is the SMILES notation for (2-tert-butyl-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl)-(2-methoxypyrimidin-5-yl)methanone?
The canonical SMILES for (2-tert-butyl-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl)-(2-methoxypyrimidin-5-yl)methanone is COc1ncc(C(=O)N2Cc3cnc(C(C)(C)C)nc3C2)cn1.
What is the InChIKey of (2-tert-butyl-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl)-(2-methoxypyrimidin-5-yl)methanone?
The InChIKey is XVKXSLCYRRKZBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19N5O2/c1-16(2,3)14-17-7-11-8-21(9-12(11)20-14)13(22)10-5-18-15(23-4)19-6-10/h5-7H,8-9H2,1-4H3.
What are the key properties of (2-tert-butyl-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl)-(2-methoxypyrimidin-5-yl)methanone?
(2-tert-butyl-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl)-(2-methoxypyrimidin-5-yl)methanone has a molecular weight of 313.36 g/mol, XLogP of 1.73, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2-tert-butyl-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl)-(2-methoxypyrimidin-5-yl)methanone is sourced from PubChem (CID 56739691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).