C12H19N3O3 — CID 56739947
2-(2-methoxyethoxy)-N-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-3-yl)acetamide (PubChem CID 56739947) has the molecular formula C12H19N3O3 and a molecular weight of 253.30 g/mol. Its IUPAC name is 2-(2-methoxyethoxy)-N-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-3-yl)acetamide.
| Compound Name | 2-(2-methoxyethoxy)-N-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-3-yl)acetamide |
|---|---|
| PubChem CID | 56739947 |
| Molecular Formula | C12H19N3O3 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.14 |
| IUPAC Name | 2-(2-methoxyethoxy)-N-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-3-yl)acetamide |
| SMILES | COCCOCC(=O)Nc1cnc2n1CCCC2 |
| InChI | InChI=1S/C12H19N3O3/c1-17-6-7-18-9-12(16)14-11-8-13-10-4-2-3-5-15(10)11/h8H,2-7,9H2,1H3,(H,14,16) |
| InChIKey | BYDSSSNPCFDSHF-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|