About 2,7-diazaspiro[4.5]decan-7-yl-(5-propan-2-yl-1,2-oxazol-3-yl)methanone
2,7-diazaspiro[4.5]decan-7-yl-(5-propan-2-yl-1,2-oxazol-3-yl)methanone (PubChem CID 56740147) has the molecular formula C15H23N3O2
and a molecular weight of 277.37 g/mol. Its IUPAC name is 2,7-diazaspiro[4.5]decan-7-yl-(5-propan-2-yl-1,2-oxazol-3-yl)methanone.
Molecular Properties
| Compound Name | 2,7-diazaspiro[4.5]decan-7-yl-(5-propan-2-yl-1,2-oxazol-3-yl)methanone |
| PubChem CID | 56740147 |
| Molecular Formula | C15H23N3O2 |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | 2,7-diazaspiro[4.5]decan-7-yl-(5-propan-2-yl-1,2-oxazol-3-yl)methanone |
| SMILES | CC(C)c1cc(C(=O)N2CCCC3(CCNC3)C2)no1 |
| InChI | InChI=1S/C15H23N3O2/c1-11(2)13-8-12(17-20-13)14(19)18-7-3-4-15(10-18)5-6-16-9-15/h8,11,16H,3-7,9-10H2,1-2H3 |
| InChIKey | LSMZYASQHYANQZ-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,7-diazaspiro[4.5]decan-7-yl-(5-propan-2-yl-1,2-oxazol-3-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,7-diazaspiro[4.5]decan-7-yl-(5-propan-2-yl-1,2-oxazol-3-yl)methanone?
The IUPAC name of 2,7-diazaspiro[4.5]decan-7-yl-(5-propan-2-yl-1,2-oxazol-3-yl)methanone (CID 56740147) is 2,7-diazaspiro[4.5]decan-7-yl-(5-propan-2-yl-1,2-oxazol-3-yl)methanone.
What is the SMILES notation for 2,7-diazaspiro[4.5]decan-7-yl-(5-propan-2-yl-1,2-oxazol-3-yl)methanone?
The canonical SMILES for 2,7-diazaspiro[4.5]decan-7-yl-(5-propan-2-yl-1,2-oxazol-3-yl)methanone is CC(C)c1cc(C(=O)N2CCCC3(CCNC3)C2)no1.
What is the InChIKey of 2,7-diazaspiro[4.5]decan-7-yl-(5-propan-2-yl-1,2-oxazol-3-yl)methanone?
The InChIKey is LSMZYASQHYANQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23N3O2/c1-11(2)13-8-12(17-20-13)14(19)18-7-3-4-15(10-18)5-6-16-9-15/h8,11,16H,3-7,9-10H2,1-2H3.
What are the key properties of 2,7-diazaspiro[4.5]decan-7-yl-(5-propan-2-yl-1,2-oxazol-3-yl)methanone?
2,7-diazaspiro[4.5]decan-7-yl-(5-propan-2-yl-1,2-oxazol-3-yl)methanone has a molecular weight of 277.37 g/mol, XLogP of 2.01, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,7-diazaspiro[4.5]decan-7-yl-(5-propan-2-yl-1,2-oxazol-3-yl)methanone is sourced from PubChem (CID 56740147), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).