About 7-(2-ethyl-5,7-dihydropyrrolo[3,4-d]pyrimidine-6-carbonyl)-3-methylquinazolin-4-one
7-(2-ethyl-5,7-dihydropyrrolo[3,4-d]pyrimidine-6-carbonyl)-3-methylquinazolin-4-one (PubChem CID 56740493) has the molecular formula C18H17N5O2
and a molecular weight of 335.37 g/mol. Its IUPAC name is 7-(2-ethyl-5,7-dihydropyrrolo[3,4-d]pyrimidine-6-carbonyl)-3-methylquinazolin-4-one.
Molecular Properties
| Compound Name | 7-(2-ethyl-5,7-dihydropyrrolo[3,4-d]pyrimidine-6-carbonyl)-3-methylquinazolin-4-one |
| PubChem CID | 56740493 |
| Molecular Formula | C18H17N5O2 |
| Molecular Weight | 335.37 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | 7-(2-ethyl-5,7-dihydropyrrolo[3,4-d]pyrimidine-6-carbonyl)-3-methylquinazolin-4-one |
| SMILES | CCc1ncc2c(n1)CN(C(=O)c1ccc3c(=O)n(C)cnc3c1)C2 |
| InChI | InChI=1S/C18H17N5O2/c1-3-16-19-7-12-8-23(9-15(12)21-16)17(24)11-4-5-13-14(6-11)20-10-22(2)18(13)25/h4-7,10H,3,8-9H2,1-2H3 |
| InChIKey | HYRLJRXFVAHHQH-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 80.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.37 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 7-(2-ethyl-5,7-dihydropyrrolo[3,4-d]pyrimidine-6-carbonyl)-3-methylquinazolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(2-ethyl-5,7-dihydropyrrolo[3,4-d]pyrimidine-6-carbonyl)-3-methylquinazolin-4-one?
The IUPAC name of 7-(2-ethyl-5,7-dihydropyrrolo[3,4-d]pyrimidine-6-carbonyl)-3-methylquinazolin-4-one (CID 56740493) is 7-(2-ethyl-5,7-dihydropyrrolo[3,4-d]pyrimidine-6-carbonyl)-3-methylquinazolin-4-one.
What is the SMILES notation for 7-(2-ethyl-5,7-dihydropyrrolo[3,4-d]pyrimidine-6-carbonyl)-3-methylquinazolin-4-one?
The canonical SMILES for 7-(2-ethyl-5,7-dihydropyrrolo[3,4-d]pyrimidine-6-carbonyl)-3-methylquinazolin-4-one is CCc1ncc2c(n1)CN(C(=O)c1ccc3c(=O)n(C)cnc3c1)C2.
What is the InChIKey of 7-(2-ethyl-5,7-dihydropyrrolo[3,4-d]pyrimidine-6-carbonyl)-3-methylquinazolin-4-one?
The InChIKey is HYRLJRXFVAHHQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17N5O2/c1-3-16-19-7-12-8-23(9-15(12)21-16)17(24)11-4-5-13-14(6-11)20-10-22(2)18(13)25/h4-7,10H,3,8-9H2,1-2H3.
What are the key properties of 7-(2-ethyl-5,7-dihydropyrrolo[3,4-d]pyrimidine-6-carbonyl)-3-methylquinazolin-4-one?
7-(2-ethyl-5,7-dihydropyrrolo[3,4-d]pyrimidine-6-carbonyl)-3-methylquinazolin-4-one has a molecular weight of 335.37 g/mol, XLogP of 1.44, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(2-ethyl-5,7-dihydropyrrolo[3,4-d]pyrimidine-6-carbonyl)-3-methylquinazolin-4-one is sourced from PubChem (CID 56740493), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).