C21H28FN3O — CID 56740545
3-(3-fluorophenyl)-5-(2,2,6,6-tetramethylpiperidin-4-yl)-6,7-dihydro-4H-[1,2]oxazolo[4,5-c]pyridine (PubChem CID 56740545) has the molecular formula C21H28FN3O and a molecular weight of 357.47 g/mol. Its IUPAC name is 3-(3-fluorophenyl)-5-(2,2,6,6-tetramethylpiperidin-4-yl)-6,7-dihydro-4H-[1,2]oxazolo[4,5-c]pyridine.
| Compound Name | 3-(3-fluorophenyl)-5-(2,2,6,6-tetramethylpiperidin-4-yl)-6,7-dihydro-4H-[1,2]oxazolo[4,5-c]pyridine |
|---|---|
| PubChem CID | 56740545 |
| Molecular Formula | C21H28FN3O |
| Molecular Weight | 357.47 g/mol |
| Exact Mass | 357.22 |
| IUPAC Name | 3-(3-fluorophenyl)-5-(2,2,6,6-tetramethylpiperidin-4-yl)-6,7-dihydro-4H-[1,2]oxazolo[4,5-c]pyridine |
| SMILES | CC1(C)CC(N2CCc3onc(-c4cccc(F)c4)c3C2)CC(C)(C)N1 |
| InChI | InChI=1S/C21H28FN3O/c1-20(2)11-16(12-21(3,4)24-20)25-9-8-18-17(13-25)19(23-26-18)14-6-5-7-15(22)10-14/h5-7,10,16,24H,8-9,11-13H2,1-4H3 |
| InChIKey | XNDGXVBRHVGNHZ-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 41.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.47 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |