C18H26N4O3 — CID 56740572
(3aS,6aR)-3-(3-morpholin-4-ylpropyl)-5-(pyridin-4-ylmethyl)-3a,4,6,6a-tetrahydropyrrolo[3,4-d][1,3]oxazol-2-one (PubChem CID 56740572) has the molecular formula C18H26N4O3 and a molecular weight of 346.43 g/mol. Its IUPAC name is (3aS,6aR)-3-(3-morpholin-4-ylpropyl)-5-(pyridin-4-ylmethyl)-3a,4,6,6a-tetrahydropyrrolo[3,4-d][1,3]oxazol-2-one.
| Compound Name | (3aS,6aR)-3-(3-morpholin-4-ylpropyl)-5-(pyridin-4-ylmethyl)-3a,4,6,6a-tetrahydropyrrolo[3,4-d][1,3]oxazol-2-one |
|---|---|
| PubChem CID | 56740572 |
| Molecular Formula | C18H26N4O3 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | (3aS,6aR)-3-(3-morpholin-4-ylpropyl)-5-(pyridin-4-ylmethyl)-3a,4,6,6a-tetrahydropyrrolo[3,4-d][1,3]oxazol-2-one |
| SMILES | O=C1O[C@@H]2CN(Cc3ccncc3)C[C@@H]2N1CCCN1CCOCC1 |
| InChI | InChI=1S/C18H26N4O3/c23-18-22(7-1-6-20-8-10-24-11-9-20)16-13-21(14-17(16)25-18)12-15-2-4-19-5-3-15/h2-5,16-17H,1,6-14H2/t16-,17+/m0/s1 |
| InChIKey | KPRSHLIZNBADRK-DLBZAZTESA-N |
| XLogP | 0.81 |
| TPSA | 58.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |