C18H25N5 — CID 56740919
N,N-dimethyl-1-(2-methylphenyl)-N'-(5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-4-yl)ethane-1,2-diamine (PubChem CID 56740919) has the molecular formula C18H25N5 and a molecular weight of 311.43 g/mol. Its IUPAC name is N,N-dimethyl-1-(2-methylphenyl)-N'-(5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-4-yl)ethane-1,2-diamine.
| Compound Name | N,N-dimethyl-1-(2-methylphenyl)-N'-(5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-4-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 56740919 |
| Molecular Formula | C18H25N5 |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.21 |
| IUPAC Name | N,N-dimethyl-1-(2-methylphenyl)-N'-(5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-4-yl)ethane-1,2-diamine |
| SMILES | Cc1ccccc1C(CNc1ncnc2c1CCNC2)N(C)C |
| InChI | InChI=1S/C18H25N5/c1-13-6-4-5-7-14(13)17(23(2)3)11-20-18-15-8-9-19-10-16(15)21-12-22-18/h4-7,12,17,19H,8-11H2,1-3H3,(H,20,21,22) |
| InChIKey | VSGOLEXIBQSUFI-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |