C15H20N4O3S — CID 56741309
N-[[1-(2,1,3-benzoxadiazol-4-ylmethyl)pyrrolidin-3-yl]methyl]prop-2-ene-1-sulfonamide (PubChem CID 56741309) has the molecular formula C15H20N4O3S and a molecular weight of 336.42 g/mol. Its IUPAC name is N-[[1-(2,1,3-benzoxadiazol-4-ylmethyl)pyrrolidin-3-yl]methyl]prop-2-ene-1-sulfonamide.
| Compound Name | N-[[1-(2,1,3-benzoxadiazol-4-ylmethyl)pyrrolidin-3-yl]methyl]prop-2-ene-1-sulfonamide |
|---|---|
| PubChem CID | 56741309 |
| Molecular Formula | C15H20N4O3S |
| Molecular Weight | 336.42 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | N-[[1-(2,1,3-benzoxadiazol-4-ylmethyl)pyrrolidin-3-yl]methyl]prop-2-ene-1-sulfonamide |
| SMILES | C=CCS(=O)(=O)NCC1CCN(Cc2cccc3nonc23)C1 |
| InChI | InChI=1S/C15H20N4O3S/c1-2-8-23(20,21)16-9-12-6-7-19(10-12)11-13-4-3-5-14-15(13)18-22-17-14/h2-5,12,16H,1,6-11H2 |
| InChIKey | ZYKVAHCJDXAZMR-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 88.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.42 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|