About 2-[5-(5-fluoro-4-pyrrolidin-1-ylpyrimidin-2-yl)-4,6-dihydropyrrolo[3,4-d]pyrazol-1-yl]ethanol
2-[5-(5-fluoro-4-pyrrolidin-1-ylpyrimidin-2-yl)-4,6-dihydropyrrolo[3,4-d]pyrazol-1-yl]ethanol (PubChem CID 56742245) has the molecular formula C15H19FN6O
and a molecular weight of 318.36 g/mol. Its IUPAC name is 2-[5-(5-fluoro-4-pyrrolidin-1-ylpyrimidin-2-yl)-4,6-dihydropyrrolo[3,4-d]pyrazol-1-yl]ethanol.
Molecular Properties
| Compound Name | 2-[5-(5-fluoro-4-pyrrolidin-1-ylpyrimidin-2-yl)-4,6-dihydropyrrolo[3,4-d]pyrazol-1-yl]ethanol |
| PubChem CID | 56742245 |
| Molecular Formula | C15H19FN6O |
| Molecular Weight | 318.36 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | 2-[5-(5-fluoro-4-pyrrolidin-1-ylpyrimidin-2-yl)-4,6-dihydropyrrolo[3,4-d]pyrazol-1-yl]ethanol |
| SMILES | OCCn1ncc2c1CN(c1ncc(F)c(N3CCCC3)n1)C2 |
| InChI | InChI=1S/C15H19FN6O/c16-12-8-17-15(19-14(12)20-3-1-2-4-20)21-9-11-7-18-22(5-6-23)13(11)10-21/h7-8,23H,1-6,9-10H2 |
| InChIKey | LBUCZCUWPPFXEG-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 70.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.36 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-[5-(5-fluoro-4-pyrrolidin-1-ylpyrimidin-2-yl)-4,6-dihydropyrrolo[3,4-d]pyrazol-1-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-(5-fluoro-4-pyrrolidin-1-ylpyrimidin-2-yl)-4,6-dihydropyrrolo[3,4-d]pyrazol-1-yl]ethanol?
The IUPAC name of 2-[5-(5-fluoro-4-pyrrolidin-1-ylpyrimidin-2-yl)-4,6-dihydropyrrolo[3,4-d]pyrazol-1-yl]ethanol (CID 56742245) is 2-[5-(5-fluoro-4-pyrrolidin-1-ylpyrimidin-2-yl)-4,6-dihydropyrrolo[3,4-d]pyrazol-1-yl]ethanol.
What is the SMILES notation for 2-[5-(5-fluoro-4-pyrrolidin-1-ylpyrimidin-2-yl)-4,6-dihydropyrrolo[3,4-d]pyrazol-1-yl]ethanol?
The canonical SMILES for 2-[5-(5-fluoro-4-pyrrolidin-1-ylpyrimidin-2-yl)-4,6-dihydropyrrolo[3,4-d]pyrazol-1-yl]ethanol is OCCn1ncc2c1CN(c1ncc(F)c(N3CCCC3)n1)C2.
What is the InChIKey of 2-[5-(5-fluoro-4-pyrrolidin-1-ylpyrimidin-2-yl)-4,6-dihydropyrrolo[3,4-d]pyrazol-1-yl]ethanol?
The InChIKey is LBUCZCUWPPFXEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19FN6O/c16-12-8-17-15(19-14(12)20-3-1-2-4-20)21-9-11-7-18-22(5-6-23)13(11)10-21/h7-8,23H,1-6,9-10H2.
What are the key properties of 2-[5-(5-fluoro-4-pyrrolidin-1-ylpyrimidin-2-yl)-4,6-dihydropyrrolo[3,4-d]pyrazol-1-yl]ethanol?
2-[5-(5-fluoro-4-pyrrolidin-1-ylpyrimidin-2-yl)-4,6-dihydropyrrolo[3,4-d]pyrazol-1-yl]ethanol has a molecular weight of 318.36 g/mol, XLogP of 0.92, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-(5-fluoro-4-pyrrolidin-1-ylpyrimidin-2-yl)-4,6-dihydropyrrolo[3,4-d]pyrazol-1-yl]ethanol is sourced from PubChem (CID 56742245), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).