C22H29N3O3 — CID 56742685
6-[4-(hydroxymethyl)piperidin-1-yl]-N-[3-(4-methoxyphenyl)propyl]pyridine-3-carboxamide (PubChem CID 56742685) has the molecular formula C22H29N3O3 and a molecular weight of 383.49 g/mol. Its IUPAC name is 6-[4-(hydroxymethyl)piperidin-1-yl]-N-[3-(4-methoxyphenyl)propyl]pyridine-3-carboxamide.
| Compound Name | 6-[4-(hydroxymethyl)piperidin-1-yl]-N-[3-(4-methoxyphenyl)propyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 56742685 |
| Molecular Formula | C22H29N3O3 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.22 |
| IUPAC Name | 6-[4-(hydroxymethyl)piperidin-1-yl]-N-[3-(4-methoxyphenyl)propyl]pyridine-3-carboxamide |
| SMILES | COc1ccc(CCCNC(=O)c2ccc(N3CCC(CO)CC3)nc2)cc1 |
| InChI | InChI=1S/C22H29N3O3/c1-28-20-7-4-17(5-8-20)3-2-12-23-22(27)19-6-9-21(24-15-19)25-13-10-18(16-26)11-14-25/h4-9,15,18,26H,2-3,10-14,16H2,1H3,(H,23,27) |
| InChIKey | BJTPJMOGQIZLIJ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|