C22H34N2O2 — CID 56743137
3-[(cyclohexylamino)methyl]-3-hydroxy-1-[(4-propan-2-ylphenyl)methyl]piperidin-2-one (PubChem CID 56743137) has the molecular formula C22H34N2O2 and a molecular weight of 358.53 g/mol. Its IUPAC name is 3-[(cyclohexylamino)methyl]-3-hydroxy-1-[(4-propan-2-ylphenyl)methyl]piperidin-2-one.
| Compound Name | 3-[(cyclohexylamino)methyl]-3-hydroxy-1-[(4-propan-2-ylphenyl)methyl]piperidin-2-one |
|---|---|
| PubChem CID | 56743137 |
| Molecular Formula | C22H34N2O2 |
| Molecular Weight | 358.53 g/mol |
| Exact Mass | 358.26 |
| IUPAC Name | 3-[(cyclohexylamino)methyl]-3-hydroxy-1-[(4-propan-2-ylphenyl)methyl]piperidin-2-one |
| SMILES | CC(C)c1ccc(CN2CCCC(O)(CNC3CCCCC3)C2=O)cc1 |
| InChI | InChI=1S/C22H34N2O2/c1-17(2)19-11-9-18(10-12-19)15-24-14-6-13-22(26,21(24)25)16-23-20-7-4-3-5-8-20/h9-12,17,20,23,26H,3-8,13-16H2,1-2H3 |
| InChIKey | DQAWPVWLTGRNPC-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.53 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |