About 1-[(3,4-difluorophenyl)methyl]-3-hydroxy-3-[(2-methoxyethylamino)methyl]piperidin-2-one
1-[(3,4-difluorophenyl)methyl]-3-hydroxy-3-[(2-methoxyethylamino)methyl]piperidin-2-one (PubChem CID 56743324) has the molecular formula C16H22F2N2O3
and a molecular weight of 328.36 g/mol. Its IUPAC name is 1-[(3,4-difluorophenyl)methyl]-3-hydroxy-3-[(2-methoxyethylamino)methyl]piperidin-2-one.
Molecular Properties
| Compound Name | 1-[(3,4-difluorophenyl)methyl]-3-hydroxy-3-[(2-methoxyethylamino)methyl]piperidin-2-one |
| PubChem CID | 56743324 |
| Molecular Formula | C16H22F2N2O3 |
| Molecular Weight | 328.36 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | 1-[(3,4-difluorophenyl)methyl]-3-hydroxy-3-[(2-methoxyethylamino)methyl]piperidin-2-one |
| SMILES | COCCNCC1(O)CCCN(Cc2ccc(F)c(F)c2)C1=O |
| InChI | InChI=1S/C16H22F2N2O3/c1-23-8-6-19-11-16(22)5-2-7-20(15(16)21)10-12-3-4-13(17)14(18)9-12/h3-4,9,19,22H,2,5-8,10-11H2,1H3 |
| InChIKey | JWSBWLSXGJAGSH-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.36 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-[(3,4-difluorophenyl)methyl]-3-hydroxy-3-[(2-methoxyethylamino)methyl]piperidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3,4-difluorophenyl)methyl]-3-hydroxy-3-[(2-methoxyethylamino)methyl]piperidin-2-one?
The IUPAC name of 1-[(3,4-difluorophenyl)methyl]-3-hydroxy-3-[(2-methoxyethylamino)methyl]piperidin-2-one (CID 56743324) is 1-[(3,4-difluorophenyl)methyl]-3-hydroxy-3-[(2-methoxyethylamino)methyl]piperidin-2-one.
What is the SMILES notation for 1-[(3,4-difluorophenyl)methyl]-3-hydroxy-3-[(2-methoxyethylamino)methyl]piperidin-2-one?
The canonical SMILES for 1-[(3,4-difluorophenyl)methyl]-3-hydroxy-3-[(2-methoxyethylamino)methyl]piperidin-2-one is COCCNCC1(O)CCCN(Cc2ccc(F)c(F)c2)C1=O.
What is the InChIKey of 1-[(3,4-difluorophenyl)methyl]-3-hydroxy-3-[(2-methoxyethylamino)methyl]piperidin-2-one?
The InChIKey is JWSBWLSXGJAGSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22F2N2O3/c1-23-8-6-19-11-16(22)5-2-7-20(15(16)21)10-12-3-4-13(17)14(18)9-12/h3-4,9,19,22H,2,5-8,10-11H2,1H3.
What are the key properties of 1-[(3,4-difluorophenyl)methyl]-3-hydroxy-3-[(2-methoxyethylamino)methyl]piperidin-2-one?
1-[(3,4-difluorophenyl)methyl]-3-hydroxy-3-[(2-methoxyethylamino)methyl]piperidin-2-one has a molecular weight of 328.36 g/mol, XLogP of 1.05, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3,4-difluorophenyl)methyl]-3-hydroxy-3-[(2-methoxyethylamino)methyl]piperidin-2-one is sourced from PubChem (CID 56743324), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).