About (2-tert-butyl-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl)-(4-methylthiadiazol-5-yl)methanone
(2-tert-butyl-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl)-(4-methylthiadiazol-5-yl)methanone (PubChem CID 56743995) has the molecular formula C14H17N5OS
and a molecular weight of 303.39 g/mol. Its IUPAC name is (2-tert-butyl-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl)-(4-methylthiadiazol-5-yl)methanone.
Molecular Properties
| Compound Name | (2-tert-butyl-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl)-(4-methylthiadiazol-5-yl)methanone |
| PubChem CID | 56743995 |
| Molecular Formula | C14H17N5OS |
| Molecular Weight | 303.39 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | (2-tert-butyl-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl)-(4-methylthiadiazol-5-yl)methanone |
| SMILES | Cc1nnsc1C(=O)N1Cc2cnc(C(C)(C)C)nc2C1 |
| InChI | InChI=1S/C14H17N5OS/c1-8-11(21-18-17-8)12(20)19-6-9-5-15-13(14(2,3)4)16-10(9)7-19/h5H,6-7H2,1-4H3 |
| InChIKey | QJMNAMANSJFNTB-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 71.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.39 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (2-tert-butyl-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl)-(4-methylthiadiazol-5-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-tert-butyl-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl)-(4-methylthiadiazol-5-yl)methanone?
The IUPAC name of (2-tert-butyl-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl)-(4-methylthiadiazol-5-yl)methanone (CID 56743995) is (2-tert-butyl-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl)-(4-methylthiadiazol-5-yl)methanone.
What is the SMILES notation for (2-tert-butyl-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl)-(4-methylthiadiazol-5-yl)methanone?
The canonical SMILES for (2-tert-butyl-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl)-(4-methylthiadiazol-5-yl)methanone is Cc1nnsc1C(=O)N1Cc2cnc(C(C)(C)C)nc2C1.
What is the InChIKey of (2-tert-butyl-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl)-(4-methylthiadiazol-5-yl)methanone?
The InChIKey is QJMNAMANSJFNTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17N5OS/c1-8-11(21-18-17-8)12(20)19-6-9-5-15-13(14(2,3)4)16-10(9)7-19/h5H,6-7H2,1-4H3.
What are the key properties of (2-tert-butyl-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl)-(4-methylthiadiazol-5-yl)methanone?
(2-tert-butyl-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl)-(4-methylthiadiazol-5-yl)methanone has a molecular weight of 303.39 g/mol, XLogP of 2.09, 1 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2-tert-butyl-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl)-(4-methylthiadiazol-5-yl)methanone is sourced from PubChem (CID 56743995), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).