About cyclopenten-1-yl-[2-(2-methylpropyl)-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl]methanone
cyclopenten-1-yl-[2-(2-methylpropyl)-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl]methanone (PubChem CID 56745369) has the molecular formula C16H21N3O
and a molecular weight of 271.36 g/mol. Its IUPAC name is cyclopenten-1-yl-[2-(2-methylpropyl)-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl]methanone.
Molecular Properties
| Compound Name | cyclopenten-1-yl-[2-(2-methylpropyl)-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl]methanone |
| PubChem CID | 56745369 |
| Molecular Formula | C16H21N3O |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.17 |
| IUPAC Name | cyclopenten-1-yl-[2-(2-methylpropyl)-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl]methanone |
| SMILES | CC(C)Cc1ncc2c(n1)CN(C(=O)C1=CCCC1)C2 |
| InChI | InChI=1S/C16H21N3O/c1-11(2)7-15-17-8-13-9-19(10-14(13)18-15)16(20)12-5-3-4-6-12/h5,8,11H,3-4,6-7,9-10H2,1-2H3 |
| InChIKey | XJTIIOZTQMJAST-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze cyclopenten-1-yl-[2-(2-methylpropyl)-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopenten-1-yl-[2-(2-methylpropyl)-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl]methanone?
The IUPAC name of cyclopenten-1-yl-[2-(2-methylpropyl)-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl]methanone (CID 56745369) is cyclopenten-1-yl-[2-(2-methylpropyl)-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl]methanone.
What is the SMILES notation for cyclopenten-1-yl-[2-(2-methylpropyl)-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl]methanone?
The canonical SMILES for cyclopenten-1-yl-[2-(2-methylpropyl)-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl]methanone is CC(C)Cc1ncc2c(n1)CN(C(=O)C1=CCCC1)C2.
What is the InChIKey of cyclopenten-1-yl-[2-(2-methylpropyl)-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl]methanone?
The InChIKey is XJTIIOZTQMJAST-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21N3O/c1-11(2)7-15-17-8-13-9-19(10-14(13)18-15)16(20)12-5-3-4-6-12/h5,8,11H,3-4,6-7,9-10H2,1-2H3.
What are the key properties of cyclopenten-1-yl-[2-(2-methylpropyl)-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl]methanone?
cyclopenten-1-yl-[2-(2-methylpropyl)-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl]methanone has a molecular weight of 271.36 g/mol, XLogP of 2.63, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopenten-1-yl-[2-(2-methylpropyl)-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl]methanone is sourced from PubChem (CID 56745369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).