About 1-[2-(2-methylpropyl)-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl]-3-(tetrazol-1-yl)propan-1-one
1-[2-(2-methylpropyl)-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl]-3-(tetrazol-1-yl)propan-1-one (PubChem CID 56745642) has the molecular formula C14H19N7O
and a molecular weight of 301.35 g/mol. Its IUPAC name is 1-[2-(2-methylpropyl)-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl]-3-(tetrazol-1-yl)propan-1-one.
Molecular Properties
| Compound Name | 1-[2-(2-methylpropyl)-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl]-3-(tetrazol-1-yl)propan-1-one |
| PubChem CID | 56745642 |
| Molecular Formula | C14H19N7O |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | 1-[2-(2-methylpropyl)-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl]-3-(tetrazol-1-yl)propan-1-one |
| SMILES | CC(C)Cc1ncc2c(n1)CN(C(=O)CCn1cnnn1)C2 |
| InChI | InChI=1S/C14H19N7O/c1-10(2)5-13-15-6-11-7-20(8-12(11)17-13)14(22)3-4-21-9-16-18-19-21/h6,9-10H,3-5,7-8H2,1-2H3 |
| InChIKey | XMZAHNLGVIECLN-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 89.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1-[2-(2-methylpropyl)-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl]-3-(tetrazol-1-yl)propan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(2-methylpropyl)-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl]-3-(tetrazol-1-yl)propan-1-one?
The IUPAC name of 1-[2-(2-methylpropyl)-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl]-3-(tetrazol-1-yl)propan-1-one (CID 56745642) is 1-[2-(2-methylpropyl)-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl]-3-(tetrazol-1-yl)propan-1-one.
What is the SMILES notation for 1-[2-(2-methylpropyl)-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl]-3-(tetrazol-1-yl)propan-1-one?
The canonical SMILES for 1-[2-(2-methylpropyl)-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl]-3-(tetrazol-1-yl)propan-1-one is CC(C)Cc1ncc2c(n1)CN(C(=O)CCn1cnnn1)C2.
What is the InChIKey of 1-[2-(2-methylpropyl)-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl]-3-(tetrazol-1-yl)propan-1-one?
The InChIKey is XMZAHNLGVIECLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19N7O/c1-10(2)5-13-15-6-11-7-20(8-12(11)17-13)14(22)3-4-21-9-16-18-19-21/h6,9-10H,3-5,7-8H2,1-2H3.
What are the key properties of 1-[2-(2-methylpropyl)-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl]-3-(tetrazol-1-yl)propan-1-one?
1-[2-(2-methylpropyl)-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl]-3-(tetrazol-1-yl)propan-1-one has a molecular weight of 301.35 g/mol, XLogP of 0.59, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(2-methylpropyl)-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl]-3-(tetrazol-1-yl)propan-1-one is sourced from PubChem (CID 56745642), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).