About bis(1-chloropropan-2-yl) 3-chloropropyl phosphate
bis(1-chloropropan-2-yl) 3-chloropropyl phosphate (PubChem CID 567457) has the molecular formula C9H18Cl3O4P
and a molecular weight of 327.57 g/mol. Its IUPAC name is bis(1-chloropropan-2-yl) 3-chloropropyl phosphate.
Molecular Properties
| Compound Name | bis(1-chloropropan-2-yl) 3-chloropropyl phosphate |
| PubChem CID | 567457 |
| Molecular Formula | C9H18Cl3O4P |
| Molecular Weight | 327.57 g/mol |
| Exact Mass | 326.00 |
| IUPAC Name | bis(1-chloropropan-2-yl) 3-chloropropyl phosphate |
| SMILES | CC(CCl)OP(=O)(OCCCCl)OC(C)CCl |
| InChI | InChI=1S/C9H18Cl3O4P/c1-8(6-11)15-17(13,14-5-3-4-10)16-9(2)7-12/h8-9H,3-7H2,1-2H3 |
| InChIKey | QELBXOLVEDEBJG-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.57 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze bis(1-chloropropan-2-yl) 3-chloropropyl phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(1-chloropropan-2-yl) 3-chloropropyl phosphate?
The IUPAC name of bis(1-chloropropan-2-yl) 3-chloropropyl phosphate (CID 567457) is bis(1-chloropropan-2-yl) 3-chloropropyl phosphate.
What is the SMILES notation for bis(1-chloropropan-2-yl) 3-chloropropyl phosphate?
The canonical SMILES for bis(1-chloropropan-2-yl) 3-chloropropyl phosphate is CC(CCl)OP(=O)(OCCCCl)OC(C)CCl.
What is the InChIKey of bis(1-chloropropan-2-yl) 3-chloropropyl phosphate?
The InChIKey is QELBXOLVEDEBJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18Cl3O4P/c1-8(6-11)15-17(13,14-5-3-4-10)16-9(2)7-12/h8-9H,3-7H2,1-2H3.
What are the key properties of bis(1-chloropropan-2-yl) 3-chloropropyl phosphate?
bis(1-chloropropan-2-yl) 3-chloropropyl phosphate has a molecular weight of 327.57 g/mol, XLogP of 4.03, 10 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(1-chloropropan-2-yl) 3-chloropropyl phosphate is sourced from PubChem (CID 567457), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).