C12H20O2 — CID 567459
6-(2-methylprop-1-enyl)-1,4-dioxaspiro[4.5]decane (PubChem CID 567459) has the molecular formula C12H20O2 and a molecular weight of 196.29 g/mol. Its IUPAC name is 6-(2-methylprop-1-enyl)-1,4-dioxaspiro[4.5]decane.
| Compound Name | 6-(2-methylprop-1-enyl)-1,4-dioxaspiro[4.5]decane |
|---|---|
| PubChem CID | 567459 |
| Molecular Formula | C12H20O2 |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.15 |
| IUPAC Name | 6-(2-methylprop-1-enyl)-1,4-dioxaspiro[4.5]decane |
| SMILES | CC(C)=CC1CCCCC12OCCO2 |
| InChI | InChI=1S/C12H20O2/c1-10(2)9-11-5-3-4-6-12(11)13-7-8-14-12/h9,11H,3-8H2,1-2H3 |
| InChIKey | IUWGJCDGWHNPOO-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|