C17H23N5O — CID 56746008
(3S,4R)-3-benzyl-1-(2,6-diaminopyrimidin-4-yl)-4-methylpiperidin-4-ol (PubChem CID 56746008) has the molecular formula C17H23N5O and a molecular weight of 313.41 g/mol. Its IUPAC name is (3S,4R)-3-benzyl-1-(2,6-diaminopyrimidin-4-yl)-4-methylpiperidin-4-ol.
| Compound Name | (3S,4R)-3-benzyl-1-(2,6-diaminopyrimidin-4-yl)-4-methylpiperidin-4-ol |
|---|---|
| PubChem CID | 56746008 |
| Molecular Formula | C17H23N5O |
| Molecular Weight | 313.41 g/mol |
| Exact Mass | 313.19 |
| IUPAC Name | (3S,4R)-3-benzyl-1-(2,6-diaminopyrimidin-4-yl)-4-methylpiperidin-4-ol |
| SMILES | C[C@@]1(O)CCN(c2cc(N)nc(N)n2)C[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C17H23N5O/c1-17(23)7-8-22(15-10-14(18)20-16(19)21-15)11-13(17)9-12-5-3-2-4-6-12/h2-6,10,13,23H,7-9,11H2,1H3,(H4,18,19,20,21)/t13-,17+/m0/s1 |
| InChIKey | JDFFYBIVTWJMNQ-SUMWQHHRSA-N |
| XLogP | 1.46 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.41 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |