C19H22N6O2 — CID 56746259
N-[2-[3-(methoxymethyl)-1,2,4-oxadiazol-5-yl]ethyl]-2-phenyl-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-4-amine (PubChem CID 56746259) has the molecular formula C19H22N6O2 and a molecular weight of 366.43 g/mol. Its IUPAC name is N-[2-[3-(methoxymethyl)-1,2,4-oxadiazol-5-yl]ethyl]-2-phenyl-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-4-amine.
| Compound Name | N-[2-[3-(methoxymethyl)-1,2,4-oxadiazol-5-yl]ethyl]-2-phenyl-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 56746259 |
| Molecular Formula | C19H22N6O2 |
| Molecular Weight | 366.43 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | N-[2-[3-(methoxymethyl)-1,2,4-oxadiazol-5-yl]ethyl]-2-phenyl-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-4-amine |
| SMILES | COCc1noc(CCNc2nc(-c3ccccc3)nc3c2CCNC3)n1 |
| InChI | InChI=1S/C19H22N6O2/c1-26-12-16-23-17(27-25-16)8-10-21-19-14-7-9-20-11-15(14)22-18(24-19)13-5-3-2-4-6-13/h2-6,20H,7-12H2,1H3,(H,21,22,24) |
| InChIKey | OXGPGTMIPPNCBC-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.43 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |