C17H26N4O — CID 56746533
N-[(7S,8aS)-2-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-7-yl]-5-methyl-2-(methylamino)benzamide (PubChem CID 56746533) has the molecular formula C17H26N4O and a molecular weight of 302.42 g/mol. Its IUPAC name is N-[(7S,8aS)-2-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-7-yl]-5-methyl-2-(methylamino)benzamide.
| Compound Name | N-[(7S,8aS)-2-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-7-yl]-5-methyl-2-(methylamino)benzamide |
|---|---|
| PubChem CID | 56746533 |
| Molecular Formula | C17H26N4O |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.21 |
| IUPAC Name | N-[(7S,8aS)-2-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-7-yl]-5-methyl-2-(methylamino)benzamide |
| SMILES | CNc1ccc(C)cc1C(=O)N[C@H]1C[C@H]2CN(C)CCN2C1 |
| InChI | InChI=1S/C17H26N4O/c1-12-4-5-16(18-2)15(8-12)17(22)19-13-9-14-11-20(3)6-7-21(14)10-13/h4-5,8,13-14,18H,6-7,9-11H2,1-3H3,(H,19,22)/t13-,14-/m0/s1 |
| InChIKey | GKKHRJCIKXCVJZ-KBPBESRZSA-N |
| XLogP | 1.15 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |